C31H25FIrN3O- — CID 171730748
1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-(1-methylimidazol-2-yl)phenol (PubChem CID 171730748) has the molecular formula C31H25FIrN3O- and a molecular weight of 666.78 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-(1-methylimidazol-2-yl)phenol.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-(1-methylimidazol-2-yl)phenol |
|---|---|
| PubChem CID | 171730748 |
| Molecular Formula | C31H25FIrN3O- |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 667.16 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;iridium;2-(1-methylimidazol-2-yl)phenol |
| SMILES | Cc1[c-]c(-c2nccc3cc(F)c4ccccc4c23)cc(C)c1.Cn1ccnc1-c1ccccc1O.[Ir] |
| InChI | InChI=1S/C21H15FN.C10H10N2O.Ir/c1-13-9-14(2)11-16(10-13)21-20-15(7-8-23-21)12-19(22)17-5-3-4-6-18(17)20;1-12-7-6-11-10(12)8-4-2-3-5-9(8)13;/h3-10,12H,1-2H3;2-7,13H,1H3;/q-1;; |
| InChIKey | ADQLGUFQJPXPEW-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|