C16H20ClNO3 — CID 171731919
5-chloro-6-(1,4-dioxan-2-ylmethoxy)-2-propan-2-yl-1H-indole (PubChem CID 171731919) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 5-chloro-6-(1,4-dioxan-2-ylmethoxy)-2-propan-2-yl-1H-indole.
| Compound Name | 5-chloro-6-(1,4-dioxan-2-ylmethoxy)-2-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 171731919 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-chloro-6-(1,4-dioxan-2-ylmethoxy)-2-propan-2-yl-1H-indole |
| SMILES | CC(C)c1cc2cc(Cl)c(OCC3COCCO3)cc2[nH]1 |
| InChI | InChI=1S/C16H20ClNO3/c1-10(2)14-6-11-5-13(17)16(7-15(11)18-14)21-9-12-8-19-3-4-20-12/h5-7,10,12,18H,3-4,8-9H2,1-2H3 |
| InChIKey | AAIVQZRTNNCJJK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |