C13H17N2O3+ — CID 171732557
[4-methoxycarbonyl-6-[(3S,4R)-4-methyloxolan-3-yl]iminocyclohexa-2,4-dien-1-ylidene]azanium (PubChem CID 171732557) has the molecular formula C13H17N2O3+ and a molecular weight of 249.29 g/mol. Its IUPAC name is [4-methoxycarbonyl-6-[(3S,4R)-4-methyloxolan-3-yl]iminocyclohexa-2,4-dien-1-ylidene]azanium.
| Compound Name | [4-methoxycarbonyl-6-[(3S,4R)-4-methyloxolan-3-yl]iminocyclohexa-2,4-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 171732557 |
| Molecular Formula | C13H17N2O3+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [4-methoxycarbonyl-6-[(3S,4R)-4-methyloxolan-3-yl]iminocyclohexa-2,4-dien-1-ylidene]azanium |
| SMILES | COC(=O)C1=C/C(=N\[C@@H]2COC[C@@H]2C)C(=[NH2+])C=C1 |
| InChI | InChI=1S/C13H16N2O3/c1-8-6-18-7-12(8)15-11-5-9(13(16)17-2)3-4-10(11)14/h3-5,8,12,14H,6-7H2,1-2H3/p+1/b14-10?,15-11+/t8-,12+/m0/s1 |
| InChIKey | DNBDBUFLXVPCMQ-NHBLCPPSSA-O |
| XLogP | -0.67 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|