C17H20S — CID 171734116
4,4-di(propan-2-yl)indeno[1,2-b]thiophene (PubChem CID 171734116) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is 4,4-di(propan-2-yl)indeno[1,2-b]thiophene.
| Compound Name | 4,4-di(propan-2-yl)indeno[1,2-b]thiophene |
|---|---|
| PubChem CID | 171734116 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4,4-di(propan-2-yl)indeno[1,2-b]thiophene |
| SMILES | CC(C)C1(C(C)C)c2ccccc2-c2sccc21 |
| InChI | InChI=1S/C17H20S/c1-11(2)17(12(3)4)14-8-6-5-7-13(14)16-15(17)9-10-18-16/h5-12H,1-4H3 |
| InChIKey | DQQJQGCZAZHHDM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |