C24H31ClN2O5 — CID 171735677
(3aR,4R,5R,6aS)-2-[2-(5-butoxy-6-chloro-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol (PubChem CID 171735677) has the molecular formula C24H31ClN2O5 and a molecular weight of 462.97 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-2-[2-(5-butoxy-6-chloro-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol.
| Compound Name | (3aR,4R,5R,6aS)-2-[2-(5-butoxy-6-chloro-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol |
|---|---|
| PubChem CID | 171735677 |
| Molecular Formula | C24H31ClN2O5 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (3aR,4R,5R,6aS)-2-[2-(5-butoxy-6-chloro-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol |
| SMILES | CCCCOc1ccc(C(O)CN2C[C@@H]3C[C@@H](Oc4ccccc4)[C@@H](O)[C@]3(O)C2)nc1Cl |
| InChI | InChI=1S/C24H31ClN2O5/c1-2-3-11-31-20-10-9-18(26-23(20)25)19(28)14-27-13-16-12-21(22(29)24(16,30)15-27)32-17-7-5-4-6-8-17/h4-10,16,19,21-22,28-30H,2-3,11-15H2,1H3/t16-,19?,21+,22+,24-/m0/s1 |
| InChIKey | WFQUZVZPWPWGTI-OFNCOKSDSA-N |
| XLogP | 2.82 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|