C25H22F2N6O — CID 171743816
5-[5-(4-amino-4-methylpiperidin-1-yl)-7-(3-fluoro-4-isocyanophenyl)imidazo[1,2-c]pyrimidin-8-yl]-2-fluorophenol (PubChem CID 171743816) has the molecular formula C25H22F2N6O and a molecular weight of 460.49 g/mol. Its IUPAC name is 5-[5-(4-amino-4-methylpiperidin-1-yl)-7-(3-fluoro-4-isocyanophenyl)imidazo[1,2-c]pyrimidin-8-yl]-2-fluorophenol.
| Compound Name | 5-[5-(4-amino-4-methylpiperidin-1-yl)-7-(3-fluoro-4-isocyanophenyl)imidazo[1,2-c]pyrimidin-8-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 171743816 |
| Molecular Formula | C25H22F2N6O |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 5-[5-(4-amino-4-methylpiperidin-1-yl)-7-(3-fluoro-4-isocyanophenyl)imidazo[1,2-c]pyrimidin-8-yl]-2-fluorophenol |
| SMILES | [C-]#[N+]c1ccc(-c2nc(N3CCC(C)(N)CC3)n3ccnc3c2-c2ccc(F)c(O)c2)cc1F |
| InChI | InChI=1S/C25H22F2N6O/c1-25(28)7-10-32(11-8-25)24-31-22(16-4-6-19(29-2)18(27)13-16)21(23-30-9-12-33(23)24)15-3-5-17(26)20(34)14-15/h3-6,9,12-14,34H,7-8,10-11,28H2,1H3 |
| InChIKey | KOZDQOOSFXDCJL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|