C15H20 — CID 171747830
3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulene (PubChem CID 171747830) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulene.
| Compound Name | 3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulene |
|---|---|
| PubChem CID | 171747830 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulene |
| SMILES | CC1=CC=C(C(C)C)CC2=C1CC=C2C |
| InChI | InChI=1S/C15H20/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | SOYMUHFHBMNDRY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |