C34H44O2 — CID 91406502
2-(3,8-dimethyl-5-propan-2-yl-4,7,8,8a-tetrahydro-3aH-azulen-1-ylidene)-4-(3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulen-1-yl)-3-hydroxycyclobutan-1-one (PubChem CID 91406502) has the molecular formula C34H44O2 and a molecular weight of 484.72 g/mol. Its IUPAC name is 2-(3,8-dimethyl-5-propan-2-yl-4,7,8,8a-tetrahydro-3aH-azulen-1-ylidene)-4-(3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulen-1-yl)-3-hydroxycyclobutan-1-one.
| Compound Name | 2-(3,8-dimethyl-5-propan-2-yl-4,7,8,8a-tetrahydro-3aH-azulen-1-ylidene)-4-(3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulen-1-yl)-3-hydroxycyclobutan-1-one |
|---|---|
| PubChem CID | 91406502 |
| Molecular Formula | C34H44O2 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 2-(3,8-dimethyl-5-propan-2-yl-4,7,8,8a-tetrahydro-3aH-azulen-1-ylidene)-4-(3,8-dimethyl-5-propan-2-yl-1,4-dihydroazulen-1-yl)-3-hydroxycyclobutan-1-one |
| SMILES | CC1=CC(C2C(=O)C(=C3C=C(C)C4CC(C(C)C)=CCC(C)C34)C2O)C2=C1CC(C(C)C)=CC=C2C |
| InChI | InChI=1S/C34H44O2/c1-17(2)23-11-9-19(5)29-25(15-23)21(7)13-27(29)31-33(35)32(34(31)36)28-14-22(8)26-16-24(18(3)4)12-10-20(6)30(26)28/h9,11-14,17-18,20,26-27,30-31,33,35H,10,15-16H2,1-8H3 |
| InChIKey | AIHVCCXYGKGJCN-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|