C27H29GeNSi — CID 171747971
[9,9-dimethyl-1-(4-methylnaphthalen-2-yl)-[1]benzogermolo[2,3-c]pyridin-7-yl]-trimethylsilane (PubChem CID 171747971) has the molecular formula C27H29GeNSi and a molecular weight of 468.23 g/mol. Its IUPAC name is [9,9-dimethyl-1-(4-methylnaphthalen-2-yl)-[1]benzogermolo[2,3-c]pyridin-7-yl]-trimethylsilane.
| Compound Name | [9,9-dimethyl-1-(4-methylnaphthalen-2-yl)-[1]benzogermolo[2,3-c]pyridin-7-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171747971 |
| Molecular Formula | C27H29GeNSi |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [9,9-dimethyl-1-(4-methylnaphthalen-2-yl)-[1]benzogermolo[2,3-c]pyridin-7-yl]-trimethylsilane |
| SMILES | Cc1cc(-c2nccc3c2[Ge](C)(C)c2cc([Si](C)(C)C)ccc2-3)cc2ccccc12 |
| InChI | InChI=1S/C27H29GeNSi/c1-18-15-20(16-19-9-7-8-10-22(18)19)27-26-24(13-14-29-27)23-12-11-21(30(4,5)6)17-25(23)28(26,2)3/h7-17H,1-6H3 |
| InChIKey | ZFMXFEQSEAVRGO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|