C25H23F2GeN — CID 171764500
[3-fluoro-4-[5-fluoro-2-(4-methylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane (PubChem CID 171764500) has the molecular formula C25H23F2GeN and a molecular weight of 448.07 g/mol. Its IUPAC name is [3-fluoro-4-[5-fluoro-2-(4-methylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane.
| Compound Name | [3-fluoro-4-[5-fluoro-2-(4-methylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane |
|---|---|
| PubChem CID | 171764500 |
| Molecular Formula | C25H23F2GeN |
| Molecular Weight | 448.07 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [3-fluoro-4-[5-fluoro-2-(4-methylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane |
| SMILES | Cc1cc(-c2cc(-c3ccc([Ge](C)(C)C)cc3F)c(F)cn2)cc2ccccc12 |
| InChI | InChI=1S/C25H23F2GeN/c1-16-11-18(12-17-7-5-6-8-20(16)17)25-14-22(24(27)15-29-25)21-10-9-19(13-23(21)26)28(2,3)4/h5-15H,1-4H3 |
| InChIKey | MKPUEMGGTDECMC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.07 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |