C17H20N2O2 — CID 171749273
[4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl prop-2-enoate (PubChem CID 171749273) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl prop-2-enoate.
| Compound Name | [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 171749273 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCn1cnc([C@@H](C)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-5-17(20)21-11-19-9-16(18-10-19)14(4)15-8-6-7-12(2)13(15)3/h5-10,14H,1,11H2,2-4H3/t14-/m0/s1 |
| InChIKey | LYUYTBKFBFSYLC-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|