C18H19NO5S — CID 171749290
benzyl (4S)-4-benzyl-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 171749290) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is benzyl (4S)-4-benzyl-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate.
| Compound Name | benzyl (4S)-4-benzyl-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 171749290 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | benzyl (4S)-4-benzyl-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
| SMILES | C[C@]1(Cc2ccccc2)COS(=O)(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO5S/c1-18(12-15-8-4-2-5-9-15)14-24-25(21,22)19(18)17(20)23-13-16-10-6-3-7-11-16/h2-11H,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | YVPNTAMCIVJBIJ-SFHVURJKSA-N |
| XLogP | 2.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |