benzyl 2,2-dioxooxathiazolidine-3-carboxylate

C10H11NO5S — CID 102432381

IUPACbenzyl 2,2-dioxooxathiazolidine-3-carboxylate
SMILESO=C(OCc1ccccc1)N1CCOS1(=O)=O
InChIInChI=1S/C10H11NO5S/c12-10(11-6-7-16-17(11,13)14)15-8-9-4-2-1-3-5-9/h1-5H,6-8H2
InChIKeyJJRUJESEFSYUEZ-UHFFFAOYSA-N
MW257.27 g/mol
LogP0.90
Rot. Bonds2

About benzyl 2,2-dioxooxathiazolidine-3-carboxylate

benzyl 2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 102432381) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is benzyl 2,2-dioxooxathiazolidine-3-carboxylate.

Molecular Properties

Compound Namebenzyl 2,2-dioxooxathiazolidine-3-carboxylate
PubChem CID102432381
Molecular FormulaC10H11NO5S
Molecular Weight257.27 g/mol
Exact Mass257.04
IUPAC Namebenzyl 2,2-dioxooxathiazolidine-3-carboxylate
SMILESO=C(OCc1ccccc1)N1CCOS1(=O)=O
InChIInChI=1S/C10H11NO5S/c12-10(11-6-7-16-17(11,13)14)15-8-9-4-2-1-3-5-9/h1-5H,6-8H2
InChIKeyJJRUJESEFSYUEZ-UHFFFAOYSA-N
XLogP0.90
TPSA72.91 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.27
LogP ≤ 50.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze benzyl 2,2-dioxooxathiazolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2,2-dioxooxathiazolidine-3-carboxylate?
The IUPAC name of benzyl 2,2-dioxooxathiazolidine-3-carboxylate (CID 102432381) is benzyl 2,2-dioxooxathiazolidine-3-carboxylate.
What is the SMILES notation for benzyl 2,2-dioxooxathiazolidine-3-carboxylate?
The canonical SMILES for benzyl 2,2-dioxooxathiazolidine-3-carboxylate is O=C(OCc1ccccc1)N1CCOS1(=O)=O.
What is the InChIKey of benzyl 2,2-dioxooxathiazolidine-3-carboxylate?
The InChIKey is JJRUJESEFSYUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5S/c12-10(11-6-7-16-17(11,13)14)15-8-9-4-2-1-3-5-9/h1-5H,6-8H2.
What are the key properties of benzyl 2,2-dioxooxathiazolidine-3-carboxylate?
benzyl 2,2-dioxooxathiazolidine-3-carboxylate has a molecular weight of 257.27 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2,2-dioxooxathiazolidine-3-carboxylate is sourced from PubChem (CID 102432381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).