C10H11NO5S — CID 102432381
benzyl 2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 102432381) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is benzyl 2,2-dioxooxathiazolidine-3-carboxylate.
| Compound Name | benzyl 2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102432381 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | benzyl 2,2-dioxooxathiazolidine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCOS1(=O)=O |
| InChI | InChI=1S/C10H11NO5S/c12-10(11-6-7-16-17(11,13)14)15-8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | JJRUJESEFSYUEZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |