C28H28BNO2 — CID 171751678
8-(4-methylphenyl)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (PubChem CID 171751678) has the molecular formula C28H28BNO2 and a molecular weight of 421.35 g/mol. Its IUPAC name is 8-(4-methylphenyl)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline.
| Compound Name | 8-(4-methylphenyl)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
|---|---|
| PubChem CID | 171751678 |
| Molecular Formula | C28H28BNO2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 8-(4-methylphenyl)-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| SMILES | Cc1ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)c3c(-c4ccccc4)cncc23)cc1 |
| InChI | InChI=1S/C28H28BNO2/c1-19-11-13-21(14-12-19)22-15-16-25(29-31-27(2,3)28(4,5)32-29)26-23(17-30-18-24(22)26)20-9-7-6-8-10-20/h6-18H,1-5H3 |
| InChIKey | LGYSPKYWVJKVOK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|