C21H25BF4O2 — CID 171759107
2-[3-[[1-(2,4-difluorophenyl)cyclopropyl]-difluoromethyl]-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171759107) has the molecular formula C21H25BF4O2 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-[3-[[1-(2,4-difluorophenyl)cyclopropyl]-difluoromethyl]-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-[[1-(2,4-difluorophenyl)cyclopropyl]-difluoromethyl]-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171759107 |
| Molecular Formula | C21H25BF4O2 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-[3-[[1-(2,4-difluorophenyl)cyclopropyl]-difluoromethyl]-1-bicyclo[1.1.1]pentanyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C23CC(C(F)(F)C4(c5ccc(F)cc5F)CC4)(C2)C3)OC1(C)C |
| InChI | InChI=1S/C21H25BF4O2/c1-16(2)17(3,4)28-22(27-16)19-10-18(11-19,12-19)21(25,26)20(7-8-20)14-6-5-13(23)9-15(14)24/h5-6,9H,7-8,10-12H2,1-4H3 |
| InChIKey | OGMFWEKABHSGLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|