C14H18FN — CID 156796258
6-fluoro-1-methylspiro[2H-indole-3,1'-cyclohexane] (PubChem CID 156796258) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is 6-fluoro-1-methylspiro[2H-indole-3,1'-cyclohexane].
| Compound Name | 6-fluoro-1-methylspiro[2H-indole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 156796258 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 6-fluoro-1-methylspiro[2H-indole-3,1'-cyclohexane] |
| SMILES | CN1CC2(CCCCC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C14H18FN/c1-16-10-14(7-3-2-4-8-14)12-6-5-11(15)9-13(12)16/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | VCCUXOJSXLZBGA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |