About (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate
(6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate (PubChem CID 171759380) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate.
Molecular Properties
| Compound Name | (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate |
| PubChem CID | 171759380 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate |
| SMILES | CNCC(=O)OCc1ccc(Cl)nc1C |
| InChI | InChI=1S/C10H13ClN2O2/c1-7-8(3-4-9(11)13-7)6-15-10(14)5-12-2/h3-4,12H,5-6H2,1-2H3 |
| InChIKey | IIIRHLBGTMPVJY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate?
The IUPAC name of (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate (CID 171759380) is (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate.
What is the SMILES notation for (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate?
The canonical SMILES for (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate is CNCC(=O)OCc1ccc(Cl)nc1C.
What is the InChIKey of (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate?
The InChIKey is IIIRHLBGTMPVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2/c1-7-8(3-4-9(11)13-7)6-15-10(14)5-12-2/h3-4,12H,5-6H2,1-2H3.
What are the key properties of (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate?
(6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate has a molecular weight of 228.68 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-2-methyl-3-pyridinyl)methyl 2-(methylamino)acetate is sourced from PubChem (CID 171759380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).