C21H19F2N3O2 — CID 171761379
3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one (PubChem CID 171761379) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one.
| Compound Name | 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 171761379 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3,3-difluoro-2,2-dimethyl-1-[(1S,9S)-6-(2-pyridin-3-ylethynyl)-8-oxa-4,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-11-yl]propan-1-one |
| SMILES | CC(C)(C(=O)N1C[C@@H]2C[C@H]1c1cncc(C#Cc3cccnc3)c1O2)C(F)F |
| InChI | InChI=1S/C21H19F2N3O2/c1-21(2,19(22)23)20(27)26-12-15-8-17(26)16-11-25-10-14(18(16)28-15)6-5-13-4-3-7-24-9-13/h3-4,7,9-11,15,17,19H,8,12H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | STLXBKIIOGWAGY-RDJZCZTQSA-N |
| XLogP | 3.20 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|