C23H27Cl2N3O2S — CID 17176588
N-[(1-benzylpiperidin-4-yl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 17176588) has the molecular formula C23H27Cl2N3O2S and a molecular weight of 480.46 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 17176588 |
| Molecular Formula | C23H27Cl2N3O2S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27Cl2N3O2S/c24-18-8-9-21(20(25)15-18)30-14-4-7-22(29)27-23(31)26-19-10-12-28(13-11-19)16-17-5-2-1-3-6-17/h1-3,5-6,8-9,15,19H,4,7,10-14,16H2,(H2,26,27,29,31) |
| InChIKey | NSHOWKLWKCEBPE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|