C19H16N2O3 — CID 171768253
2-[[4-(4-cyanophenyl)benzoyl]amino]ethyl prop-2-enoate (PubChem CID 171768253) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[[4-(4-cyanophenyl)benzoyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[4-(4-cyanophenyl)benzoyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 171768253 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[[4-(4-cyanophenyl)benzoyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H16N2O3/c1-2-18(22)24-12-11-21-19(23)17-9-7-16(8-10-17)15-5-3-14(13-20)4-6-15/h2-10H,1,11-12H2,(H,21,23) |
| InChIKey | BFIRCBWKLRAHNJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|