C14H18Cl2N2O4 — CID 171770392
ethyl 2-[2-[2-(2,4-dichlorophenoxy)acetyl]-2-methylhydrazinyl]propanoate (PubChem CID 171770392) has the molecular formula C14H18Cl2N2O4 and a molecular weight of 349.21 g/mol. Its IUPAC name is ethyl 2-[2-[2-(2,4-dichlorophenoxy)acetyl]-2-methylhydrazinyl]propanoate.
| Compound Name | ethyl 2-[2-[2-(2,4-dichlorophenoxy)acetyl]-2-methylhydrazinyl]propanoate |
|---|---|
| PubChem CID | 171770392 |
| Molecular Formula | C14H18Cl2N2O4 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | ethyl 2-[2-[2-(2,4-dichlorophenoxy)acetyl]-2-methylhydrazinyl]propanoate |
| SMILES | CCOC(=O)C(C)NN(C)C(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O4/c1-4-21-14(20)9(2)17-18(3)13(19)8-22-12-6-5-10(15)7-11(12)16/h5-7,9,17H,4,8H2,1-3H3 |
| InChIKey | GILWIYQCMGDQIF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|