C40H50N4P+ — CID 171770395
tert-butyl-dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium (PubChem CID 171770395) has the molecular formula C40H50N4P+ and a molecular weight of 617.84 g/mol. Its IUPAC name is tert-butyl-dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium.
| Compound Name | tert-butyl-dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium |
|---|---|
| PubChem CID | 171770395 |
| Molecular Formula | C40H50N4P+ |
| Molecular Weight | 617.84 g/mol |
| Exact Mass | 617.38 |
| IUPAC Name | tert-butyl-dicyclohexyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium |
| SMILES | CC(C)(C)[P+](C1=CCNN1c1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C40H50N4P/c1-40(2,3)45(34-25-15-7-16-26-34,35-27-17-8-18-28-35)36-29-30-41-44(36)39-37(31-19-9-4-10-20-31)42-43(33-23-13-6-14-24-33)38(39)32-21-11-5-12-22-32/h4-6,9-14,19-24,29,34-35,41H,7-8,15-18,25-28,30H2,1-3H3/q+1 |
| InChIKey | WVNLOXPLPMWKFT-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.84 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|