C36H46N4P+ — CID 171770394
tritert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium (PubChem CID 171770394) has the molecular formula C36H46N4P+ and a molecular weight of 565.77 g/mol. Its IUPAC name is tritert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium.
| Compound Name | tritert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium |
|---|---|
| PubChem CID | 171770394 |
| Molecular Formula | C36H46N4P+ |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | tritert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)-1,5-dihydropyrazol-3-yl]phosphanium |
| SMILES | CC(C)(C)[P+](C1=CCNN1c1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H46N4P/c1-34(2,3)41(35(4,5)6,36(7,8)9)30-25-26-37-40(30)33-31(27-19-13-10-14-20-27)38-39(29-23-17-12-18-24-29)32(33)28-21-15-11-16-22-28/h10-25,37H,26H2,1-9H3/q+1 |
| InChIKey | MBJOMHXUGPSWAW-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|