C9H10IN — CID 171774591
5-iodo-1,2,3,5-tetrahydroquinoline (PubChem CID 171774591) has the molecular formula C9H10IN and a molecular weight of 259.09 g/mol. Its IUPAC name is 5-iodo-1,2,3,5-tetrahydroquinoline.
| Compound Name | 5-iodo-1,2,3,5-tetrahydroquinoline |
|---|---|
| PubChem CID | 171774591 |
| Molecular Formula | C9H10IN |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 5-iodo-1,2,3,5-tetrahydroquinoline |
| SMILES | IC1C=CC=C2NCCC=C21 |
| InChI | InChI=1S/C9H10IN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,3-5,8,11H,2,6H2 |
| InChIKey | CSGOFABGVHIEKE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|