C11H16N2 — CID 143140494
2,7-diazabicyclo[6.5.0]trideca-1(13),8,10-triene (PubChem CID 143140494) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,7-diazabicyclo[6.5.0]trideca-1(13),8,10-triene.
| Compound Name | 2,7-diazabicyclo[6.5.0]trideca-1(13),8,10-triene |
|---|---|
| PubChem CID | 143140494 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,7-diazabicyclo[6.5.0]trideca-1(13),8,10-triene |
| SMILES | C1=CCC=C2NCCCCNC2=C1 |
| InChI | InChI=1S/C11H16N2/c1-2-6-10-11(7-3-1)13-9-5-4-8-12-10/h1-2,6-7,12-13H,3-5,8-9H2 |
| InChIKey | MMEHJNVBEJLSIU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |