C14H11NO — CID 163466679
6,10-dihydrocyclohepta[c]isoquinolin-5-one (PubChem CID 163466679) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 6,10-dihydrocyclohepta[c]isoquinolin-5-one.
| Compound Name | 6,10-dihydrocyclohepta[c]isoquinolin-5-one |
|---|---|
| PubChem CID | 163466679 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 6,10-dihydrocyclohepta[c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2c(c3ccccc13)=CCC=CC=2 |
| InChI | InChI=1S/C14H11NO/c16-14-12-8-5-4-6-10(12)11-7-2-1-3-9-13(11)15-14/h1,3-9H,2H2,(H,15,16) |
| InChIKey | BTERKECLGBVNMO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |