C26H34N4 — CID 135479962
(3R,8R)-2,9,17,24-tetrazatetracyclo[23.5.0.03,8.010,16]triaconta-1,9,11,13,15,25,27,29-octaene (PubChem CID 135479962) has the molecular formula C26H34N4 and a molecular weight of 402.59 g/mol. Its IUPAC name is (3R,8R)-2,9,17,24-tetrazatetracyclo[23.5.0.03,8.010,16]triaconta-1,9,11,13,15,25,27,29-octaene.
| Compound Name | (3R,8R)-2,9,17,24-tetrazatetracyclo[23.5.0.03,8.010,16]triaconta-1,9,11,13,15,25,27,29-octaene |
|---|---|
| PubChem CID | 135479962 |
| Molecular Formula | C26H34N4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (3R,8R)-2,9,17,24-tetrazatetracyclo[23.5.0.03,8.010,16]triaconta-1,9,11,13,15,25,27,29-octaene |
| SMILES | C1=CC=C2NCCCCCCNC3=CC=CC=C/C3=N\[C@@H]3CCCC[C@H]3/N=C/2C=C1 |
| InChI | InChI=1S/C26H34N4/c1-2-12-20-28-22-14-6-4-8-16-24(22)30-26-18-10-9-17-25(26)29-23-15-7-3-5-13-21(23)27-19-11-1/h3-8,13-16,25-28H,1-2,9-12,17-20H2/b29-23+,30-24+/t25-,26-/m1/s1 |
| InChIKey | PGUSVQKCKGMKQL-SULOCPFHSA-N |
| XLogP | 4.95 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|