C29H32N4O2 — CID 177423552
(12S)-3,12-dibenzyl-2,5,10,13-tetrazabicyclo[12.5.0]nonadeca-1,14,16,18-tetraene-4,11-dione (PubChem CID 177423552) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is (12S)-3,12-dibenzyl-2,5,10,13-tetrazabicyclo[12.5.0]nonadeca-1,14,16,18-tetraene-4,11-dione.
| Compound Name | (12S)-3,12-dibenzyl-2,5,10,13-tetrazabicyclo[12.5.0]nonadeca-1,14,16,18-tetraene-4,11-dione |
|---|---|
| PubChem CID | 177423552 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (12S)-3,12-dibenzyl-2,5,10,13-tetrazabicyclo[12.5.0]nonadeca-1,14,16,18-tetraene-4,11-dione |
| SMILES | O=C1NCCCCNC(=O)[C@H](Cc2ccccc2)NC2=CC=CC=C/C2=N\C1Cc1ccccc1 |
| InChI | InChI=1S/C29H32N4O2/c34-28-26(20-22-12-4-1-5-13-22)32-24-16-8-3-9-17-25(24)33-27(21-23-14-6-2-7-15-23)29(35)31-19-11-10-18-30-28/h1-9,12-17,26-27,32H,10-11,18-21H2,(H,30,34)(H,31,35)/b33-25+/t26-,27?/m0/s1 |
| InChIKey | GNSDYLASWCCPHO-QZLUCQCOSA-N |
| XLogP | 3.28 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|