C11H13N3O — CID 15149735
5-benzyl-3-methyl-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 15149735) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-benzyl-3-methyl-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 5-benzyl-3-methyl-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 15149735 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-benzyl-3-methyl-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | CC1=NC(Cc2ccccc2)C(=O)NN1 |
| InChI | InChI=1S/C11H13N3O/c1-8-12-10(11(15)14-13-8)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | ZJRDHFSMTNCBHO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |