About 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one
2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one (PubChem CID 13155804) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one.
Molecular Properties
| Compound Name | 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one |
| PubChem CID | 13155804 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one |
| SMILES | CC1=CC(=O)NC(Cc2ccccc2)S1 |
| InChI | InChI=1S/C12H13NOS/c1-9-7-11(14)13-12(15-9)8-10-5-3-2-4-6-10/h2-7,12H,8H2,1H3,(H,13,14) |
| InChIKey | ITNLCTBUDUYMLB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one?
The IUPAC name of 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one (CID 13155804) is 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one.
What is the SMILES notation for 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one?
The canonical SMILES for 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one is CC1=CC(=O)NC(Cc2ccccc2)S1.
What is the InChIKey of 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one?
The InChIKey is ITNLCTBUDUYMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS/c1-9-7-11(14)13-12(15-9)8-10-5-3-2-4-6-10/h2-7,12H,8H2,1H3,(H,13,14).
What are the key properties of 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one?
2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one has a molecular weight of 219.31 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-methyl-2,3-dihydro-1,3-thiazin-4-one is sourced from PubChem (CID 13155804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).