C11H10F3N3O — CID 110455935
5-benzyl-3-(trifluoromethyl)-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 110455935) has the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. Its IUPAC name is 5-benzyl-3-(trifluoromethyl)-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 5-benzyl-3-(trifluoromethyl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 110455935 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-benzyl-3-(trifluoromethyl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | O=C1NNC(C(F)(F)F)=NC1Cc1ccccc1 |
| InChI | InChI=1S/C11H10F3N3O/c12-11(13,14)10-15-8(9(18)16-17-10)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,15,17)(H,16,18) |
| InChIKey | QKQYVXFJSPRBKP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |