C13H10BrF6NO2 — CID 87668592
4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (PubChem CID 87668592) has the molecular formula C13H10BrF6NO2 and a molecular weight of 406.12 g/mol. Its IUPAC name is 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
| Compound Name | 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 87668592 |
| Molecular Formula | C13H10BrF6NO2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| SMILES | O=C1OC(C(F)(F)F)(C(F)(F)F)N(CBr)C1Cc1ccccc1 |
| InChI | InChI=1S/C13H10BrF6NO2/c14-7-21-9(6-8-4-2-1-3-5-8)10(22)23-11(21,12(15,16)17)13(18,19)20/h1-5,9H,6-7H2 |
| InChIKey | LDDKEBHRXUJICT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|