About 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one
4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (PubChem CID 87668592) has the molecular formula C13H10BrF6NO2
and a molecular weight of 406.12 g/mol. Its IUPAC name is 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| PubChem CID | 87668592 |
| Molecular Formula | C13H10BrF6NO2 |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| SMILES | O=C1OC(C(F)(F)F)(C(F)(F)F)N(CBr)C1Cc1ccccc1 |
| InChI | InChI=1S/C13H10BrF6NO2/c14-7-21-9(6-8-4-2-1-3-5-8)10(22)23-11(21,12(15,16)17)13(18,19)20/h1-5,9H,6-7H2 |
| InChIKey | LDDKEBHRXUJICT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The IUPAC name of 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (CID 87668592) is 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
What is the SMILES notation for 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The canonical SMILES for 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one is O=C1OC(C(F)(F)F)(C(F)(F)F)N(CBr)C1Cc1ccccc1.
What is the InChIKey of 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The InChIKey is LDDKEBHRXUJICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrF6NO2/c14-7-21-9(6-8-4-2-1-3-5-8)10(22)23-11(21,12(15,16)17)13(18,19)20/h1-5,9H,6-7H2.
What are the key properties of 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one has a molecular weight of 406.12 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3-(bromomethyl)-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one is sourced from PubChem (CID 87668592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).