C14H13F3N2O2 — CID 101467534
(6R)-6-benzyl-3-methylidene-1-(2,2,2-trifluoroethyl)piperazine-2,5-dione (PubChem CID 101467534) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is (6R)-6-benzyl-3-methylidene-1-(2,2,2-trifluoroethyl)piperazine-2,5-dione.
| Compound Name | (6R)-6-benzyl-3-methylidene-1-(2,2,2-trifluoroethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 101467534 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (6R)-6-benzyl-3-methylidene-1-(2,2,2-trifluoroethyl)piperazine-2,5-dione |
| SMILES | C=C1NC(=O)[C@@H](Cc2ccccc2)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C14H13F3N2O2/c1-9-13(21)19(8-14(15,16)17)11(12(20)18-9)7-10-5-3-2-4-6-10/h2-6,11H,1,7-8H2,(H,18,20)/t11-/m1/s1 |
| InChIKey | NQZUVSOGTQCHFH-LLVKDONJSA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|