C9H10O2 — CID 142930509
3,8-dihydro-2H-cyclohepta[b][1,4]dioxine (PubChem CID 142930509) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 3,8-dihydro-2H-cyclohepta[b][1,4]dioxine.
| Compound Name | 3,8-dihydro-2H-cyclohepta[b][1,4]dioxine |
|---|---|
| PubChem CID | 142930509 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3,8-dihydro-2H-cyclohepta[b][1,4]dioxine |
| SMILES | C1=CCC=C2OCCOC2=C1 |
| InChI | InChI=1S/C9H10O2/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-2,4-5H,3,6-7H2 |
| InChIKey | JFYWBSFIUFIHKC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |