C17H25FO2 — CID 171776215
[(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] 2-fluoroprop-2-enoate (PubChem CID 171776215) has the molecular formula C17H25FO2 and a molecular weight of 280.38 g/mol. Its IUPAC name is [(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] 2-fluoroprop-2-enoate.
| Compound Name | [(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 171776215 |
| Molecular Formula | C17H25FO2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OCC/C=C/CCC/C=C\C/C=C\CC |
| InChI | InChI=1S/C17H25FO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20-17(19)16(2)18/h4-5,7-8,12-13H,2-3,6,9-11,14-15H2,1H3/b5-4-,8-7-,13-12+ |
| InChIKey | JJAORPFNRMVMPP-XBZOLNABSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|