C27H23Br2FN4O2S2 — CID 171778264
1-[(3,4-dibromophenyl)methyl]-3-[(4-fluorophenyl)methyl]-1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 171778264) has the molecular formula C27H23Br2FN4O2S2 and a molecular weight of 678.45 g/mol. Its IUPAC name is 1-[(3,4-dibromophenyl)methyl]-3-[(4-fluorophenyl)methyl]-1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(3,4-dibromophenyl)methyl]-3-[(4-fluorophenyl)methyl]-1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 171778264 |
| Molecular Formula | C27H23Br2FN4O2S2 |
| Molecular Weight | 678.45 g/mol |
| Exact Mass | 675.96 |
| IUPAC Name | 1-[(3,4-dibromophenyl)methyl]-3-[(4-fluorophenyl)methyl]-1-(pyridin-4-ylmethyl)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(N(Cc2ccc(F)cc2)C(=S)N(Cc2ccncc2)Cc2ccc(Br)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H23Br2FN4O2S2/c28-25-10-3-21(15-26(25)29)17-33(16-20-11-13-32-14-12-20)27(37)34(18-19-1-4-22(30)5-2-19)23-6-8-24(9-7-23)38(31,35)36/h1-15H,16-18H2,(H2,31,35,36) |
| InChIKey | XCGLETOTGFIPIS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|