C20H19BrN4O2S2 — CID 171778396
1-[(2-bromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea (PubChem CID 171778396) has the molecular formula C20H19BrN4O2S2 and a molecular weight of 491.44 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 171778396 |
| Molecular Formula | C20H19BrN4O2S2 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(N(Cc2ccccc2Br)C(=S)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H19BrN4O2S2/c21-19-4-2-1-3-16(19)14-25(17-5-7-18(8-6-17)29(22,26)27)20(28)24-13-15-9-11-23-12-10-15/h1-12H,13-14H2,(H,24,28)(H2,22,26,27) |
| InChIKey | HQDGUQXTOGIGJG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|