C20H18Br2N4O2S2 — CID 171778407
1-[(2,5-dibromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea (PubChem CID 171778407) has the molecular formula C20H18Br2N4O2S2 and a molecular weight of 570.33 g/mol. Its IUPAC name is 1-[(2,5-dibromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[(2,5-dibromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 171778407 |
| Molecular Formula | C20H18Br2N4O2S2 |
| Molecular Weight | 570.33 g/mol |
| Exact Mass | 567.92 |
| IUPAC Name | 1-[(2,5-dibromophenyl)methyl]-3-(pyridin-4-ylmethyl)-1-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(N(Cc2cc(Br)ccc2Br)C(=S)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H18Br2N4O2S2/c21-16-1-6-19(22)15(11-16)13-26(17-2-4-18(5-3-17)30(23,27)28)20(29)25-12-14-7-9-24-10-8-14/h1-11H,12-13H2,(H,25,29)(H2,23,27,28) |
| InChIKey | KZZVWMAJAJAEBJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|