About methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate
methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate (PubChem CID 171784211) has the molecular formula C17H15N3O2S
and a molecular weight of 325.39 g/mol. Its IUPAC name is methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate |
| PubChem CID | 171784211 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate |
| SMILES | COC(=O)c1ccc(C2CC2c2nc(C)nc3scnc23)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c1-9-19-14(15-16(20-9)23-8-18-15)13-7-12(13)10-3-5-11(6-4-10)17(21)22-2/h3-6,8,12-13H,7H2,1-2H3 |
| InChIKey | KALNMTCTLSGLOB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate?
The IUPAC name of methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate (CID 171784211) is methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate.
What is the SMILES notation for methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate?
The canonical SMILES for methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate is COC(=O)c1ccc(C2CC2c2nc(C)nc3scnc23)cc1.
What is the InChIKey of methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate?
The InChIKey is KALNMTCTLSGLOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O2S/c1-9-19-14(15-16(20-9)23-8-18-15)13-7-12(13)10-3-5-11(6-4-10)17(21)22-2/h3-6,8,12-13H,7H2,1-2H3.
What are the key properties of methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate?
methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate has a molecular weight of 325.39 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(5-methyl-[1,3]thiazolo[5,4-d]pyrimidin-7-yl)cyclopropyl]benzoate is sourced from PubChem (CID 171784211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).