C14H18ClNO4 — CID 171788140
methyl 6-chloro-7-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine-8-carboxylate (PubChem CID 171788140) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is methyl 6-chloro-7-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine-8-carboxylate.
| Compound Name | methyl 6-chloro-7-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine-8-carboxylate |
|---|---|
| PubChem CID | 171788140 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 6-chloro-7-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine-8-carboxylate |
| SMILES | COC(=O)c1c(OC)c(Cl)cc2c1OCCN2C(C)C |
| InChI | InChI=1S/C14H18ClNO4/c1-8(2)16-5-6-20-13-10(16)7-9(15)12(18-3)11(13)14(17)19-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | SRKGZQWCWQRWBR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|