C10H11BrClNO2 — CID 177336657
8-bromo-6-chloro-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 177336657) has the molecular formula C10H11BrClNO2 and a molecular weight of 292.56 g/mol. Its IUPAC name is 8-bromo-6-chloro-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 8-bromo-6-chloro-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 177336657 |
| Molecular Formula | C10H11BrClNO2 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 8-bromo-6-chloro-7-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | COc1c(Cl)cc2c(c1Br)OCCN2C |
| InChI | InChI=1S/C10H11BrClNO2/c1-13-3-4-15-10-7(13)5-6(12)9(14-2)8(10)11/h5H,3-4H2,1-2H3 |
| InChIKey | SLGPHFMECAEUOF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|