C20H30O4 — CID 171788418
3-acetyl-1-(2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane (PubChem CID 171788418) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-acetyl-1-(2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane.
| Compound Name | 3-acetyl-1-(2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane |
|---|---|
| PubChem CID | 171788418 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-acetyl-1-(2-ethyl-3-methoxyphenyl)heptane-1,6-dione;ethane |
| SMILES | CC.CCc1c(OC)cccc1C(=O)CC(CCC(C)=O)C(C)=O |
| InChI | InChI=1S/C18H24O4.C2H6/c1-5-15-16(7-6-8-18(15)22-4)17(21)11-14(13(3)20)10-9-12(2)19;1-2/h6-8,14H,5,9-11H2,1-4H3;1-2H3 |
| InChIKey | RBGAAPVOOYXVDD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |