C23H30ClN3 — CID 171793515
9-(2-aminoethyl)-N-(3-chloro-4-methylphenyl)-5,6,7,8-tetrahydrocarbazol-3-amine;ethane (PubChem CID 171793515) has the molecular formula C23H30ClN3 and a molecular weight of 383.97 g/mol. Its IUPAC name is 9-(2-aminoethyl)-N-(3-chloro-4-methylphenyl)-5,6,7,8-tetrahydrocarbazol-3-amine;ethane.
| Compound Name | 9-(2-aminoethyl)-N-(3-chloro-4-methylphenyl)-5,6,7,8-tetrahydrocarbazol-3-amine;ethane |
|---|---|
| PubChem CID | 171793515 |
| Molecular Formula | C23H30ClN3 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 9-(2-aminoethyl)-N-(3-chloro-4-methylphenyl)-5,6,7,8-tetrahydrocarbazol-3-amine;ethane |
| SMILES | CC.Cc1ccc(Nc2ccc3c(c2)c2c(n3CCN)CCCC2)cc1Cl |
| InChI | InChI=1S/C21H24ClN3.C2H6/c1-14-6-7-16(13-19(14)22)24-15-8-9-21-18(12-15)17-4-2-3-5-20(17)25(21)11-10-23;1-2/h6-9,12-13,24H,2-5,10-11,23H2,1H3;1-2H3 |
| InChIKey | CUYOYTRUUKCPBU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|