C15H17NO2 — CID 171795281
[4-[(3Z,5Z)-3-aminohepta-1,3,5-trien-4-yl]phenyl]methyl formate (PubChem CID 171795281) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is [4-[(3Z,5Z)-3-aminohepta-1,3,5-trien-4-yl]phenyl]methyl formate.
| Compound Name | [4-[(3Z,5Z)-3-aminohepta-1,3,5-trien-4-yl]phenyl]methyl formate |
|---|---|
| PubChem CID | 171795281 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | [4-[(3Z,5Z)-3-aminohepta-1,3,5-trien-4-yl]phenyl]methyl formate |
| SMILES | C=C/C(N)=C(\C=C/C)c1ccc(COC=O)cc1 |
| InChI | InChI=1S/C15H17NO2/c1-3-5-14(15(16)4-2)13-8-6-12(7-9-13)10-18-11-17/h3-9,11H,2,10,16H2,1H3/b5-3-,15-14- |
| InChIKey | KOHWRMBOENZUGS-IZIBRMAOSA-N |
| XLogP | 2.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|