C14H24FNO5 — CID 171797234
tert-butyl 2-(3-fluorooxy-1-methoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate (PubChem CID 171797234) has the molecular formula C14H24FNO5 and a molecular weight of 305.35 g/mol. Its IUPAC name is tert-butyl 2-(3-fluorooxy-1-methoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-fluorooxy-1-methoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171797234 |
| Molecular Formula | C14H24FNO5 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl 2-(3-fluorooxy-1-methoxy-2-methyl-3-oxopropyl)pyrrolidine-1-carboxylate |
| SMILES | COC(C(C)C(=O)OF)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24FNO5/c1-9(12(17)21-15)11(19-5)10-7-6-8-16(10)13(18)20-14(2,3)4/h9-11H,6-8H2,1-5H3 |
| InChIKey | NIISTJHTYGYDTB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |