C42H70N9+ — CID 171814392
28,42-dimethyl-30-methylidene-34-pentyl-3,10,19,26,29,32,35,43-octaza-42-azoniapentacyclo[35.4.1.112,17.04,9.020,25]tritetraconta-1(41),12(43),13,16,28,37(42),38-heptaene (PubChem CID 171814392) has the molecular formula C42H70N9+ and a molecular weight of 701.08 g/mol. Its IUPAC name is 28,42-dimethyl-30-methylidene-34-pentyl-3,10,19,26,29,32,35,43-octaza-42-azoniapentacyclo[35.4.1.112,17.04,9.020,25]tritetraconta-1(41),12(43),13,16,28,37(42),38-heptaene.
| Compound Name | 28,42-dimethyl-30-methylidene-34-pentyl-3,10,19,26,29,32,35,43-octaza-42-azoniapentacyclo[35.4.1.112,17.04,9.020,25]tritetraconta-1(41),12(43),13,16,28,37(42),38-heptaene |
|---|---|
| PubChem CID | 171814392 |
| Molecular Formula | C42H70N9+ |
| Molecular Weight | 701.08 g/mol |
| Exact Mass | 700.57 |
| IUPAC Name | 28,42-dimethyl-30-methylidene-34-pentyl-3,10,19,26,29,32,35,43-octaza-42-azoniapentacyclo[35.4.1.112,17.04,9.020,25]tritetraconta-1(41),12(43),13,16,28,37(42),38-heptaene |
| SMILES | C=C1CNCC(CCCCC)NCC2=[N+](C)C(=CCC=C2)CNC2CCCCC2NCC2=NC(=CCC=C2)CNC2CCCCC2NC/C(C)=N/1 |
| InChI | InChI=1S/C42H70N9/c1-5-6-7-16-34-27-43-25-32(2)49-33(3)26-45-39-21-12-13-22-40(39)46-28-35-17-8-9-18-36(50-35)29-47-41-23-14-15-24-42(41)48-31-38-20-11-10-19-37(30-44-34)51(38)4/h9-10,17-20,34,39-48H,2,5-8,11-16,21-31H2,1,3-4H3/q+1/b49-33+ |
| InChIKey | TUMGXZUSZYBTHG-WBTPITFISA-N |
| XLogP | 5.30 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.08 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|