C13H18ClFN2O3 — CID 171815259
tert-butyl N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 171815259) has the molecular formula C13H18ClFN2O3 and a molecular weight of 304.75 g/mol. Its IUPAC name is tert-butyl N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | tert-butyl N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 171815259 |
| Molecular Formula | C13H18ClFN2O3 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | tert-butyl N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO)Cc1ccnc(Cl)c1F |
| InChI | InChI=1S/C13H18ClFN2O3/c1-13(2,3)20-12(19)17(6-7-18)8-9-4-5-16-11(14)10(9)15/h4-5,18H,6-8H2,1-3H3 |
| InChIKey | PAIUPGKAIJTPCJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|