C23H31N7O2 — CID 171820762
N-[1-[1-(2,2-dimethoxyethyl)piperidin-4-yl]pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 171820762) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-[1-[1-(2,2-dimethoxyethyl)piperidin-4-yl]pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[1-[1-(2,2-dimethoxyethyl)piperidin-4-yl]pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 171820762 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | N-[1-[1-(2,2-dimethoxyethyl)piperidin-4-yl]pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C=C/C=C(\C)c1cnc(Nc2cnn(C3CCN(CC(OC)OC)CC3)c2)c2nccn12 |
| InChI | InChI=1S/C23H31N7O2/c1-5-6-17(2)20-14-25-22(23-24-9-12-29(20)23)27-18-13-26-30(15-18)19-7-10-28(11-8-19)16-21(31-3)32-4/h5-6,9,12-15,19,21H,1,7-8,10-11,16H2,2-4H3,(H,25,27)/b17-6+ |
| InChIKey | SRJTWICKQFFILO-UBKPWBPPSA-N |
| XLogP | 3.51 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|