C22H19F3N2O5 — CID 171823464
tert-butyl N-(1,3-dioxoisoindol-2-yl)-N-[6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate (PubChem CID 171823464) has the molecular formula C22H19F3N2O5 and a molecular weight of 448.40 g/mol. Its IUPAC name is tert-butyl N-(1,3-dioxoisoindol-2-yl)-N-[6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate.
| Compound Name | tert-butyl N-(1,3-dioxoisoindol-2-yl)-N-[6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate |
|---|---|
| PubChem CID | 171823464 |
| Molecular Formula | C22H19F3N2O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | tert-butyl N-(1,3-dioxoisoindol-2-yl)-N-[6-(trifluoromethyl)-2,3-dihydro-1-benzofuran-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1COc2cc(C(F)(F)F)ccc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19F3N2O5/c1-21(2,3)32-20(30)26(27-18(28)13-6-4-5-7-14(13)19(27)29)16-11-31-17-10-12(22(23,24)25)8-9-15(16)17/h4-10,16H,11H2,1-3H3 |
| InChIKey | YKPVRUCXMYTRPH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|