C16H24NO4P — CID 171487776
tert-butyl N-[(3S)-6-dimethylphosphoryl-2,3-dihydro-1-benzofuran-3-yl]-N-methylcarbamate (PubChem CID 171487776) has the molecular formula C16H24NO4P and a molecular weight of 325.35 g/mol. Its IUPAC name is tert-butyl N-[(3S)-6-dimethylphosphoryl-2,3-dihydro-1-benzofuran-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3S)-6-dimethylphosphoryl-2,3-dihydro-1-benzofuran-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171487776 |
| Molecular Formula | C16H24NO4P |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl N-[(3S)-6-dimethylphosphoryl-2,3-dihydro-1-benzofuran-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1COc2cc(P(C)(C)=O)ccc21 |
| InChI | InChI=1S/C16H24NO4P/c1-16(2,3)21-15(18)17(4)13-10-20-14-9-11(22(5,6)19)7-8-12(13)14/h7-9,13H,10H2,1-6H3/t13-/m1/s1 |
| InChIKey | FLHOBMSUIODVEF-CYBMUJFWSA-N |
| XLogP | 3.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|